C25H26N4O3 — CID 10765077
3-[2-(6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)ethyl]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 10765077) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-[2-(6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)ethyl]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-[2-(6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)ethyl]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 10765077 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-[2-(6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)ethyl]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | COc1cccc2c1CCC1CN(CCn3c(=O)[nH]c4c([nH]c5ccccc54)c3=O)CC21 |
| InChI | InChI=1S/C25H26N4O3/c1-32-21-8-4-6-16-17(21)10-9-15-13-28(14-19(15)16)11-12-29-24(30)23-22(27-25(29)31)18-5-2-3-7-20(18)26-23/h2-8,15,19,26H,9-14H2,1H3,(H,27,31) |
| InChIKey | WIRHRVAPDHCAEN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |