C9H14ClN3O4S — CID 107651136
8-(2-chloroethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 107651136) has the molecular formula C9H14ClN3O4S and a molecular weight of 295.75 g/mol. Its IUPAC name is 8-(2-chloroethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-chloroethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 107651136 |
| Molecular Formula | C9H14ClN3O4S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 8-(2-chloroethylsulfonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(S(=O)(=O)CCCl)CC2)N1 |
| InChI | InChI=1S/C9H14ClN3O4S/c10-3-6-18(16,17)13-4-1-9(2-5-13)7(14)11-8(15)12-9/h1-6H2,(H2,11,12,14,15) |
| InChIKey | NRWMHPBEFJBKNU-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|