C9H15ClN4O2S — CID 107651266
2-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]ethanesulfonamide (PubChem CID 107651266) has the molecular formula C9H15ClN4O2S and a molecular weight of 278.77 g/mol. Its IUPAC name is 2-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651266 |
| Molecular Formula | C9H15ClN4O2S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]ethanesulfonamide |
| SMILES | CC(NS(=O)(=O)CCCl)c1nnc2n1CCC2 |
| InChI | InChI=1S/C9H15ClN4O2S/c1-7(13-17(15,16)6-4-10)9-12-11-8-3-2-5-14(8)9/h7,13H,2-6H2,1H3 |
| InChIKey | IFPNVGMRUTZVLP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|