C14H18FNO4S — CID 107651323
3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(3-methoxypropyl)-N-methylbenzenesulfonamide (PubChem CID 107651323) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(3-methoxypropyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(3-methoxypropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107651323 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(3-methoxypropyl)-N-methylbenzenesulfonamide |
| SMILES | COCCCN(C)S(=O)(=O)c1ccc(C#CCO)c(F)c1 |
| InChI | InChI=1S/C14H18FNO4S/c1-16(8-4-10-20-2)21(18,19)13-7-6-12(5-3-9-17)14(15)11-13/h6-7,11,17H,4,8-10H2,1-2H3 |
| InChIKey | WQTFGONTSJRBCM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|