C12H25ClN2O2S — CID 107651664
2-chloro-N-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]ethanesulfonamide (PubChem CID 107651664) has the molecular formula C12H25ClN2O2S and a molecular weight of 296.86 g/mol. Its IUPAC name is 2-chloro-N-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651664 |
| Molecular Formula | C12H25ClN2O2S |
| Molecular Weight | 296.86 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-chloro-N-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]ethanesulfonamide |
| SMILES | CC1CCCC(CNS(=O)(=O)CCCl)(N(C)C)C1 |
| InChI | InChI=1S/C12H25ClN2O2S/c1-11-5-4-6-12(9-11,15(2)3)10-14-18(16,17)8-7-13/h11,14H,4-10H2,1-3H3 |
| InChIKey | YLYBJRZFSIKTQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.86 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|