About 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide
2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide (PubChem CID 107652566) has the molecular formula C8H16ClNO3S
and a molecular weight of 241.74 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide |
| PubChem CID | 107652566 |
| Molecular Formula | C8H16ClNO3S |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide |
| SMILES | CC1(C)C(O)CC1NS(=O)(=O)CCCl |
| InChI | InChI=1S/C8H16ClNO3S/c1-8(2)6(5-7(8)11)10-14(12,13)4-3-9/h6-7,10-11H,3-5H2,1-2H3 |
| InChIKey | FNPPUFBGDXGOPM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide?
The IUPAC name of 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide (CID 107652566) is 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide.
What is the SMILES notation for 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide?
The canonical SMILES for 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide is CC1(C)C(O)CC1NS(=O)(=O)CCCl.
What is the InChIKey of 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide?
The InChIKey is FNPPUFBGDXGOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClNO3S/c1-8(2)6(5-7(8)11)10-14(12,13)4-3-9/h6-7,10-11H,3-5H2,1-2H3.
What are the key properties of 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide?
2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide has a molecular weight of 241.74 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide is sourced from PubChem (CID 107652566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).