C30H30N2O — CID 10765287
(3'S,5'R)-4-benzyl-1',3-diphenylspiro[1,2,4-oxadiazole-5,4'-adamantane] (PubChem CID 10765287) has the molecular formula C30H30N2O and a molecular weight of 434.58 g/mol. Its IUPAC name is (3'S,5'R)-4-benzyl-1',3-diphenylspiro[1,2,4-oxadiazole-5,4'-adamantane].
| Compound Name | (3'S,5'R)-4-benzyl-1',3-diphenylspiro[1,2,4-oxadiazole-5,4'-adamantane] |
|---|---|
| PubChem CID | 10765287 |
| Molecular Formula | C30H30N2O |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (3'S,5'R)-4-benzyl-1',3-diphenylspiro[1,2,4-oxadiazole-5,4'-adamantane] |
| SMILES | c1ccc(CN2C(c3ccccc3)=NOC23[C@@H]2CC4C[C@H]3CC(c3ccccc3)(C4)C2)cc1 |
| InChI | InChI=1S/C30H30N2O/c1-4-10-22(11-5-1)21-32-28(24-12-6-2-7-13-24)31-33-30(32)26-16-23-17-27(30)20-29(18-23,19-26)25-14-8-3-9-15-25/h1-15,23,26-27H,16-21H2/t23?,26-,27+,29?,30? |
| InChIKey | SNWRGDQQALJPQB-OPQJPIDASA-N |
| XLogP | 6.35 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |