C12H12Cl2N2O3 — CID 107653893
3-(3,5-dichlorophenyl)-6-methoxy-1,3-diazepane-2,4-dione (PubChem CID 107653893) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-6-methoxy-1,3-diazepane-2,4-dione.
| Compound Name | 3-(3,5-dichlorophenyl)-6-methoxy-1,3-diazepane-2,4-dione |
|---|---|
| PubChem CID | 107653893 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-6-methoxy-1,3-diazepane-2,4-dione |
| SMILES | COC1CNC(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)C1 |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-19-10-5-11(17)16(12(18)15-6-10)9-3-7(13)2-8(14)4-9/h2-4,10H,5-6H2,1H3,(H,15,18) |
| InChIKey | OZODQFVKDJDHDA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |