C27H36O3Si — CID 10765397
methyl (2E,5S,6R,7E)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylnona-2,7-dienoate (PubChem CID 10765397) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is methyl (2E,5S,6R,7E)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylnona-2,7-dienoate.
| Compound Name | methyl (2E,5S,6R,7E)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylnona-2,7-dienoate |
|---|---|
| PubChem CID | 10765397 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl (2E,5S,6R,7E)-5-[tert-butyl(diphenyl)silyl]oxy-6-methylnona-2,7-dienoate |
| SMILES | C/C=C/[C@@H](C)[C@H](C/C=C/C(=O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H36O3Si/c1-7-15-22(2)25(20-14-21-26(28)29-6)30-31(27(3,4)5,23-16-10-8-11-17-23)24-18-12-9-13-19-24/h7-19,21-22,25H,20H2,1-6H3/b15-7+,21-14+/t22-,25+/m1/s1 |
| InChIKey | WZMWKIAUSYEGIO-DKURSNJWSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|