C25H46O4Si — CID 10765487
(2R,3R)-2-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 10765487) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (2R,3R)-2-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3R)-2-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10765487 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (2R,3R)-2-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@H]1OC(=O)C=C[C@H]1CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O4Si/c1-11-13-14-18(3)24(27-8)19(4)21(29-30(9,10)25(5,6)7)17-22-20(12-2)15-16-23(26)28-22/h11,13,15-16,18-22,24H,12,14,17H2,1-10H3/b13-11+/t18-,19-,20+,21+,22+,24+/m0/s1 |
| InChIKey | BRXUAROHWBRDKP-OVECNMCOSA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|