C20H13F6NO4 — CID 10765734
ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxo-4H-isoquinoline-4-carboxylate (PubChem CID 10765734) has the molecular formula C20H13F6NO4 and a molecular weight of 445.32 g/mol. Its IUPAC name is ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxo-4H-isoquinoline-4-carboxylate.
| Compound Name | ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxo-4H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 10765734 |
| Molecular Formula | C20H13F6NO4 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | ethyl 2-[3,5-bis(trifluoromethyl)phenyl]-1,3-dioxo-4H-isoquinoline-4-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H13F6NO4/c1-2-31-18(30)15-13-5-3-4-6-14(13)16(28)27(17(15)29)12-8-10(19(21,22)23)7-11(9-12)20(24,25)26/h3-9,15H,2H2,1H3 |
| InChIKey | FSOPOGFEUKBHHW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|