About (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one
(3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one (PubChem CID 10765821) has the molecular formula C17H25Br2NOSi
and a molecular weight of 447.29 g/mol. Its IUPAC name is (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one |
| PubChem CID | 10765821 |
| Molecular Formula | C17H25Br2NOSi |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@@H](CC#CCBr)[C@@H]1CC#CCBr |
| InChI | InChI=1S/C17H25Br2NOSi/c1-17(2,3)22(4,5)20-15(11-7-9-13-19)14(16(20)21)10-6-8-12-18/h14-15H,10-13H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | MKCQPEGRNUTPCA-GJZGRUSLSA-N |
| XLogP | 4.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one?
The IUPAC name of (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one (CID 10765821) is (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one.
What is the SMILES notation for (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one?
The canonical SMILES for (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one is CC(C)(C)[Si](C)(C)N1C(=O)[C@@H](CC#CCBr)[C@@H]1CC#CCBr.
What is the InChIKey of (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one?
The InChIKey is MKCQPEGRNUTPCA-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H25Br2NOSi/c1-17(2,3)22(4,5)20-15(11-7-9-13-19)14(16(20)21)10-6-8-12-18/h14-15H,10-13H2,1-5H3/t14-,15-/m0/s1.
What are the key properties of (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one?
(3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one has a molecular weight of 447.29 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-bis(4-bromobut-2-ynyl)-1-[tert-butyl(dimethyl)silyl]azetidin-2-one is sourced from PubChem (CID 10765821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).