C16H16FN3O — CID 107658503
2-(2-fluoro-3-methylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide (PubChem CID 107658503) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(2-fluoro-3-methylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide.
| Compound Name | 2-(2-fluoro-3-methylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107658503 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(2-fluoro-3-methylphenoxy)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(nc1Oc1cccc(C)c1F)CCC2 |
| InChI | InChI=1S/C16H16FN3O/c1-9-4-2-7-13(14(9)17)21-16-11(15(18)19)8-10-5-3-6-12(10)20-16/h2,4,7-8H,3,5-6H2,1H3,(H3,18,19) |
| InChIKey | VDWQIAUIWYLQFA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|