C15H14BrCl2NO — CID 107659517
1-[3-(4-bromo-2,5-dichlorophenoxy)-4-methylphenyl]-N-methylmethanamine (PubChem CID 107659517) has the molecular formula C15H14BrCl2NO and a molecular weight of 375.09 g/mol. Its IUPAC name is 1-[3-(4-bromo-2,5-dichlorophenoxy)-4-methylphenyl]-N-methylmethanamine.
| Compound Name | 1-[3-(4-bromo-2,5-dichlorophenoxy)-4-methylphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107659517 |
| Molecular Formula | C15H14BrCl2NO |
| Molecular Weight | 375.09 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 1-[3-(4-bromo-2,5-dichlorophenoxy)-4-methylphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(C)c(Oc2cc(Cl)c(Br)cc2Cl)c1 |
| InChI | InChI=1S/C15H14BrCl2NO/c1-9-3-4-10(8-19-2)5-14(9)20-15-7-12(17)11(16)6-13(15)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | AUNOLGGUWRDNFX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.09 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|