About trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate
trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate (PubChem CID 10765977) has the molecular formula C30H30N2O2
and a molecular weight of 450.58 g/mol. Its IUPAC name is trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate |
| PubChem CID | 10765977 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C[C@@H]1c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C30H30N2O2/c1-2-3-19-34-29(33)27-20-26(27)28-21-32(22-31-28)30(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,21-22,26-27H,2-3,19-20H2,1H3/t26-,27-/m0/s1 |
| InChIKey | FZOSQQVOZXPZOV-SVBPBHIXSA-N |
| XLogP | 6.17 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate?
The IUPAC name of trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate (CID 10765977) is trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate?
The canonical SMILES for trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate is CCCCOC(=O)[C@H]1C[C@@H]1c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1.
What is the InChIKey of trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate?
The InChIKey is FZOSQQVOZXPZOV-SVBPBHIXSA-N. The full InChI is InChI=1S/C30H30N2O2/c1-2-3-19-34-29(33)27-20-26(27)28-21-32(22-31-28)30(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,21-22,26-27H,2-3,19-20H2,1H3/t26-,27-/m0/s1.
What are the key properties of trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate?
trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate has a molecular weight of 450.58 g/mol, XLogP of 6.17, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-butyl (1S,2S)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 10765977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).