C11H12BrCl2NO — CID 107659779
6-bromo-5,8-dichloro-N-ethyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 107659779) has the molecular formula C11H12BrCl2NO and a molecular weight of 325.03 g/mol. Its IUPAC name is 6-bromo-5,8-dichloro-N-ethyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-5,8-dichloro-N-ethyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 107659779 |
| Molecular Formula | C11H12BrCl2NO |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 6-bromo-5,8-dichloro-N-ethyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCNC1CCOc2c(Cl)cc(Br)c(Cl)c21 |
| InChI | InChI=1S/C11H12BrCl2NO/c1-2-15-8-3-4-16-11-7(13)5-6(12)10(14)9(8)11/h5,8,15H,2-4H2,1H3 |
| InChIKey | XKQDXWHNGIPQJJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|