C13H18FNO — CID 107659828
8-fluoro-7-methyl-N-propyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 107659828) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 8-fluoro-7-methyl-N-propyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 8-fluoro-7-methyl-N-propyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 107659828 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 8-fluoro-7-methyl-N-propyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCCNC1CCOc2c1ccc(C)c2F |
| InChI | InChI=1S/C13H18FNO/c1-3-7-15-11-6-8-16-13-10(11)5-4-9(2)12(13)14/h4-5,11,15H,3,6-8H2,1-2H3 |
| InChIKey | LGAPZDFHXQMPLK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |