C15H6F9NO3S — CID 10765996
(1-cyanoazulen-6-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 10765996) has the molecular formula C15H6F9NO3S and a molecular weight of 451.27 g/mol. Its IUPAC name is (1-cyanoazulen-6-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (1-cyanoazulen-6-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 10765996 |
| Molecular Formula | C15H6F9NO3S |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | (1-cyanoazulen-6-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | N#Cc1ccc2ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C15H6F9NO3S/c16-12(17,14(20,21)22)13(18,19)15(23,24)29(26,27)28-10-4-3-8-1-2-9(7-25)11(8)6-5-10/h1-6H |
| InChIKey | TVRWQUDUFMNLNK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|