C29H28NO2P — CID 10766107
2-[(4S)-2-(7-ethoxynaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl-diphenylphosphane (PubChem CID 10766107) has the molecular formula C29H28NO2P and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[(4S)-2-(7-ethoxynaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl-diphenylphosphane.
| Compound Name | 2-[(4S)-2-(7-ethoxynaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl-diphenylphosphane |
|---|---|
| PubChem CID | 10766107 |
| Molecular Formula | C29H28NO2P |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[(4S)-2-(7-ethoxynaphthalen-1-yl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl-diphenylphosphane |
| SMILES | CCOc1ccc2cccc(C3=N[C@@H](CCP(c4ccccc4)c4ccccc4)CO3)c2c1 |
| InChI | InChI=1S/C29H28NO2P/c1-2-31-24-17-16-22-10-9-15-27(28(22)20-24)29-30-23(21-32-29)18-19-33(25-11-5-3-6-12-25)26-13-7-4-8-14-26/h3-17,20,23H,2,18-19,21H2,1H3/t23-/m0/s1 |
| InChIKey | OEMVVHDOPUCYFR-QHCPKHFHSA-N |
| XLogP | 5.91 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|