C14H14BrCl2NO2 — CID 107661115
1-[4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]-N-methylmethanamine (PubChem CID 107661115) has the molecular formula C14H14BrCl2NO2 and a molecular weight of 379.08 g/mol. Its IUPAC name is 1-[4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]-N-methylmethanamine.
| Compound Name | 1-[4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107661115 |
| Molecular Formula | C14H14BrCl2NO2 |
| Molecular Weight | 379.08 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 1-[4-[(4-bromo-2,5-dichlorophenoxy)methyl]-5-methylfuran-2-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(COc2cc(Cl)c(Br)cc2Cl)c(C)o1 |
| InChI | InChI=1S/C14H14BrCl2NO2/c1-8-9(3-10(20-8)6-18-2)7-19-14-5-12(16)11(15)4-13(14)17/h3-5,18H,6-7H2,1-2H3 |
| InChIKey | OQEFCPVTADXXCC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.08 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|