About N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine
N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine (PubChem CID 107662972) has the molecular formula C15H18BrCl2NO
and a molecular weight of 379.13 g/mol. Its IUPAC name is N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine |
| PubChem CID | 107662972 |
| Molecular Formula | C15H18BrCl2NO |
| Molecular Weight | 379.13 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine |
| SMILES | CCCc1c(CNC(C)C)oc2c(Cl)cc(Br)c(Cl)c12 |
| InChI | InChI=1S/C15H18BrCl2NO/c1-4-5-9-12(7-19-8(2)3)20-15-11(17)6-10(16)14(18)13(9)15/h6,8,19H,4-5,7H2,1-3H3 |
| InChIKey | PEKFPGJMJVADGI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.13 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine?
The IUPAC name of N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine (CID 107662972) is N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine.
What is the SMILES notation for N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine?
The canonical SMILES for N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine is CCCc1c(CNC(C)C)oc2c(Cl)cc(Br)c(Cl)c12.
What is the InChIKey of N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine?
The InChIKey is PEKFPGJMJVADGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrCl2NO/c1-4-5-9-12(7-19-8(2)3)20-15-11(17)6-10(16)14(18)13(9)15/h6,8,19H,4-5,7H2,1-3H3.
What are the key properties of N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine?
N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine has a molecular weight of 379.13 g/mol, XLogP of 5.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromo-4,7-dichloro-3-propyl-1-benzofuran-2-yl)methyl]propan-2-amine is sourced from PubChem (CID 107662972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).