C23H27ClN4O2S — CID 10766334
N-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylpropanamide (PubChem CID 10766334) has the molecular formula C23H27ClN4O2S and a molecular weight of 459.02 g/mol. Its IUPAC name is N-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylpropanamide.
| Compound Name | N-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 10766334 |
| Molecular Formula | C23H27ClN4O2S |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)NCC(=O)N1CCN(C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C23H27ClN4O2S/c1-15(31)23(30)26-14-20(29)27-9-11-28(12-10-27)22-19-7-6-18(24)13-17(19)5-4-16-3-2-8-25-21(16)22/h2-3,6-8,13,15,22,31H,4-5,9-12,14H2,1H3,(H,26,30) |
| InChIKey | JMSJKAZJFPCPAD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|