C13H10F2O4S6 — CID 10766400
dimethyl 2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 10766400) has the molecular formula C13H10F2O4S6 and a molecular weight of 460.62 g/mol. Its IUPAC name is dimethyl 2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10766400 |
| Molecular Formula | C13H10F2O4S6 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 459.89 |
| IUPAC Name | dimethyl 2-(6,6-difluoro-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(SCC(F)(F)CS3)S2)S1 |
| InChI | InChI=1S/C13H10F2O4S6/c1-18-7(16)5-6(8(17)19-2)23-11(22-5)12-24-9-10(25-12)21-4-13(14,15)3-20-9/h3-4H2,1-2H3 |
| InChIKey | KHJUTAQMKSVRRQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |