C18H21NOS — CID 107664941
4-[(4-butan-2-ylphenoxy)methyl]benzenecarbothioamide (PubChem CID 107664941) has the molecular formula C18H21NOS and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-[(4-butan-2-ylphenoxy)methyl]benzenecarbothioamide.
| Compound Name | 4-[(4-butan-2-ylphenoxy)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107664941 |
| Molecular Formula | C18H21NOS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[(4-butan-2-ylphenoxy)methyl]benzenecarbothioamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(N)=S)cc2)cc1 |
| InChI | InChI=1S/C18H21NOS/c1-3-13(2)15-8-10-17(11-9-15)20-12-14-4-6-16(7-5-14)18(19)21/h4-11,13H,3,12H2,1-2H3,(H2,19,21) |
| InChIKey | OYHCZLKJIDEQOT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|