C10H13FN2O2 — CID 107665477
2-[4-(aminomethyl)-2-fluorophenoxy]propanamide (PubChem CID 107665477) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-fluorophenoxy]propanamide.
| Compound Name | 2-[4-(aminomethyl)-2-fluorophenoxy]propanamide |
|---|---|
| PubChem CID | 107665477 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[4-(aminomethyl)-2-fluorophenoxy]propanamide |
| SMILES | CC(Oc1ccc(CN)cc1F)C(N)=O |
| InChI | InChI=1S/C10H13FN2O2/c1-6(10(13)14)15-9-3-2-7(5-12)4-8(9)11/h2-4,6H,5,12H2,1H3,(H2,13,14) |
| InChIKey | QXONLVFQDFURBF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |