C26H32N4O2S — CID 10766575
6-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 10766575) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 6-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 10766575 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 6-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc(-c3cn4c(n3)SCC4)cc2)CC1 |
| InChI | InChI=1S/C26H32N4O2S/c1-31-25-7-3-2-6-24(25)29-15-13-28(14-16-29)12-4-5-18-32-22-10-8-21(9-11-22)23-20-30-17-19-33-26(30)27-23/h2-3,6-11,20H,4-5,12-19H2,1H3 |
| InChIKey | LBOZKVKBJGHTTI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|