C12H10BrFN2O2S — CID 107666206
4-[(5-bromothiophen-2-yl)methoxy]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107666206) has the molecular formula C12H10BrFN2O2S and a molecular weight of 345.19 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methoxy]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(5-bromothiophen-2-yl)methoxy]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107666206 |
| Molecular Formula | C12H10BrFN2O2S |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methoxy]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCc2ccc(Br)s2)c(F)c1 |
| InChI | InChI=1S/C12H10BrFN2O2S/c13-11-4-2-8(19-11)6-18-10-3-1-7(5-9(10)14)12(15)16-17/h1-5,17H,6H2,(H2,15,16) |
| InChIKey | VVPLLXVRSDCIKX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|