C12H12FN3O3 — CID 107667208
4-[4-(aminomethyl)-2-fluorophenoxy]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 107667208) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-2-fluorophenoxy]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(aminomethyl)-2-fluorophenoxy]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 107667208 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-[4-(aminomethyl)-2-fluorophenoxy]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(Oc2ccc(CN)cc2F)nc[nH]c1=O |
| InChI | InChI=1S/C12H12FN3O3/c1-18-10-11(17)15-6-16-12(10)19-9-3-2-7(5-14)4-8(9)13/h2-4,6H,5,14H2,1H3,(H,15,16,17) |
| InChIKey | RIUBROBBNFPPKH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |