C18H24N2O — CID 107668187
N-[[2-(4-butan-2-ylphenoxy)-3-pyridinyl]methyl]ethanamine (PubChem CID 107668187) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[[2-(4-butan-2-ylphenoxy)-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[2-(4-butan-2-ylphenoxy)-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107668187 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[[2-(4-butan-2-ylphenoxy)-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cccnc1Oc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C18H24N2O/c1-4-14(3)15-8-10-17(11-9-15)21-18-16(13-19-5-2)7-6-12-20-18/h6-12,14,19H,4-5,13H2,1-3H3 |
| InChIKey | DBCYMSAZKUODNI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |