C25H22N4O6 — CID 10766889
methyl 6-cyano-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,3-dioxo-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-9-carboxylate (PubChem CID 10766889) has the molecular formula C25H22N4O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is methyl 6-cyano-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,3-dioxo-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-9-carboxylate.
| Compound Name | methyl 6-cyano-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,3-dioxo-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-9-carboxylate |
|---|---|
| PubChem CID | 10766889 |
| Molecular Formula | C25H22N4O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | methyl 6-cyano-2-[4-(2,5-dioxopyrrol-1-yl)butyl]-1,3-dioxo-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-9-carboxylate |
| SMILES | COC(=O)n1c2c(c3cc(C#N)ccc31)CC1C(=O)N(CCCCN3C(=O)C=CC3=O)C(=O)C1C2 |
| InChI | InChI=1S/C25H22N4O6/c1-35-25(34)29-19-5-4-14(13-26)10-15(19)16-11-17-18(12-20(16)29)24(33)28(23(17)32)9-3-2-8-27-21(30)6-7-22(27)31/h4-7,10,17-18H,2-3,8-9,11-12H2,1H3 |
| InChIKey | MPPXLMARCJYUMA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 129.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|