C14H13FN2O2 — CID 107670559
N-(5-amino-2-fluorophenyl)-4-hydroxy-2-methylbenzamide (PubChem CID 107670559) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-4-hydroxy-2-methylbenzamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-4-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 107670559 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-4-hydroxy-2-methylbenzamide |
| SMILES | Cc1cc(O)ccc1C(=O)Nc1cc(N)ccc1F |
| InChI | InChI=1S/C14H13FN2O2/c1-8-6-10(18)3-4-11(8)14(19)17-13-7-9(16)2-5-12(13)15/h2-7,18H,16H2,1H3,(H,17,19) |
| InChIKey | NFANQCDMQNBEFK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|