C11H11F3O4 — CID 107671114
2-methyl-4-(2,2,2-trifluoroethoxymethoxy)benzoic acid (PubChem CID 107671114) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-methyl-4-(2,2,2-trifluoroethoxymethoxy)benzoic acid.
| Compound Name | 2-methyl-4-(2,2,2-trifluoroethoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 107671114 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-methyl-4-(2,2,2-trifluoroethoxymethoxy)benzoic acid |
| SMILES | Cc1cc(OCOCC(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C11H11F3O4/c1-7-4-8(2-3-9(7)10(15)16)18-6-17-5-11(12,13)14/h2-4H,5-6H2,1H3,(H,15,16) |
| InChIKey | FVHAADIVLCNNFH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|