C32H39NO3 — CID 10767248
(4S,5S)-5-nonyl-4-(trityloxymethyl)-1,3-oxazolidin-2-one (PubChem CID 10767248) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is (4S,5S)-5-nonyl-4-(trityloxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-nonyl-4-(trityloxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10767248 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (4S,5S)-5-nonyl-4-(trityloxymethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCC[C@@H]1OC(=O)N[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H39NO3/c1-2-3-4-5-6-7-17-24-30-29(33-31(34)36-30)25-35-32(26-18-11-8-12-19-26,27-20-13-9-14-21-27)28-22-15-10-16-23-28/h8-16,18-23,29-30H,2-7,17,24-25H2,1H3,(H,33,34)/t29-,30-/m0/s1 |
| InChIKey | RYBGNPXXEZAJKF-KYJUHHDHSA-N |
| XLogP | 7.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|