C14H13N3O4 — CID 107672683
2-methyl-4-[6-(methylcarbamoyl)pyridazin-3-yl]oxybenzoic acid (PubChem CID 107672683) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-methyl-4-[6-(methylcarbamoyl)pyridazin-3-yl]oxybenzoic acid.
| Compound Name | 2-methyl-4-[6-(methylcarbamoyl)pyridazin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 107672683 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-methyl-4-[6-(methylcarbamoyl)pyridazin-3-yl]oxybenzoic acid |
| SMILES | CNC(=O)c1ccc(Oc2ccc(C(=O)O)c(C)c2)nn1 |
| InChI | InChI=1S/C14H13N3O4/c1-8-7-9(3-4-10(8)14(19)20)21-12-6-5-11(16-17-12)13(18)15-2/h3-7H,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | BOZYIMINJUXEJT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |