C26H54O4Si2 — CID 10767293
(E)-1-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol (PubChem CID 10767293) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is (E)-1-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol.
| Compound Name | (E)-1-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol |
|---|---|
| PubChem CID | 10767293 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | (E)-1-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol |
| SMILES | CC/C=C(\C)C(O)[C@]1(C)O[C@H]1[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O4Si2/c1-15-16-21(8)23(27)26(12)24(29-26)22(30-31(13,14)25(9,10)11)17-28-32(18(2)3,19(4)5)20(6)7/h16,18-20,22-24,27H,15,17H2,1-14H3/b21-16+/t22-,23?,24+,26+/m1/s1 |
| InChIKey | UEGUGONUZLGFPG-VOSRFNTPSA-N |
| XLogP | 7.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|