C23H21F6NO4 — CID 10767346
tert-butyl 2-acetyloxy-2-[bis[4-(trifluoromethyl)phenyl]methylideneamino]acetate (PubChem CID 10767346) has the molecular formula C23H21F6NO4 and a molecular weight of 489.41 g/mol. Its IUPAC name is tert-butyl 2-acetyloxy-2-[bis[4-(trifluoromethyl)phenyl]methylideneamino]acetate.
| Compound Name | tert-butyl 2-acetyloxy-2-[bis[4-(trifluoromethyl)phenyl]methylideneamino]acetate |
|---|---|
| PubChem CID | 10767346 |
| Molecular Formula | C23H21F6NO4 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | tert-butyl 2-acetyloxy-2-[bis[4-(trifluoromethyl)phenyl]methylideneamino]acetate |
| SMILES | CC(=O)OC(N=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H21F6NO4/c1-13(31)33-19(20(32)34-21(2,3)4)30-18(14-5-9-16(10-6-14)22(24,25)26)15-7-11-17(12-8-15)23(27,28)29/h5-12,19H,1-4H3 |
| InChIKey | QEECLQRLKDVXAR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|