C28H36N4O4 — CID 10767452
3-(diethylamino)-N-[8-[3-(diethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide (PubChem CID 10767452) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 3-(diethylamino)-N-[8-[3-(diethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide.
| Compound Name | 3-(diethylamino)-N-[8-[3-(diethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
|---|---|
| PubChem CID | 10767452 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 3-(diethylamino)-N-[8-[3-(diethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
| SMILES | CCN(CC)CCC(=O)Nc1cccc2c1C(=O)c1c(NC(=O)CCN(CC)CC)cccc1C2=O |
| InChI | InChI=1S/C28H36N4O4/c1-5-31(6-2)17-15-23(33)29-21-13-9-11-19-25(21)28(36)26-20(27(19)35)12-10-14-22(26)30-24(34)16-18-32(7-3)8-4/h9-14H,5-8,15-18H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | DHHZSQSAPLVDAV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|