C13H12FN3O2 — CID 107674528
N-(5-amino-4-methyl-2-pyridinyl)-2-fluoro-4-hydroxybenzamide (PubChem CID 107674528) has the molecular formula C13H12FN3O2 and a molecular weight of 261.26 g/mol. Its IUPAC name is N-(5-amino-4-methyl-2-pyridinyl)-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-(5-amino-4-methyl-2-pyridinyl)-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 107674528 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-(5-amino-4-methyl-2-pyridinyl)-2-fluoro-4-hydroxybenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(O)cc2F)ncc1N |
| InChI | InChI=1S/C13H12FN3O2/c1-7-4-12(16-6-11(7)15)17-13(19)9-3-2-8(18)5-10(9)14/h2-6,18H,15H2,1H3,(H,16,17,19) |
| InChIKey | FPKZHQYUPJRRQN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |