C13H11NO4S — CID 107674668
2-[(4-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 107674668) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(4-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 107674668 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(4-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)Nc2sccc2C(=O)O)ccc1O |
| InChI | InChI=1S/C13H11NO4S/c1-7-6-8(2-3-10(7)15)11(16)14-12-9(13(17)18)4-5-19-12/h2-6,15H,1H3,(H,14,16)(H,17,18) |
| InChIKey | PQPWSFDAVLYWDO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |