C12H11FN2O3 — CID 107675415
2-fluoro-4-[(1-methylpyrazol-4-yl)methoxy]benzoic acid (PubChem CID 107675415) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-fluoro-4-[(1-methylpyrazol-4-yl)methoxy]benzoic acid.
| Compound Name | 2-fluoro-4-[(1-methylpyrazol-4-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107675415 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-fluoro-4-[(1-methylpyrazol-4-yl)methoxy]benzoic acid |
| SMILES | Cn1cc(COc2ccc(C(=O)O)c(F)c2)cn1 |
| InChI | InChI=1S/C12H11FN2O3/c1-15-6-8(5-14-15)7-18-9-2-3-10(12(16)17)11(13)4-9/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | BXOWLUXJAPGGKI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |