C15H21N3O2S — CID 107676088
2-[4-(4-hydroxy-3-methylbenzoyl)piperazin-1-yl]propanethioamide (PubChem CID 107676088) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-3-methylbenzoyl)piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-(4-hydroxy-3-methylbenzoyl)piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 107676088 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[4-(4-hydroxy-3-methylbenzoyl)piperazin-1-yl]propanethioamide |
| SMILES | Cc1cc(C(=O)N2CCN(C(C)C(N)=S)CC2)ccc1O |
| InChI | InChI=1S/C15H21N3O2S/c1-10-9-12(3-4-13(10)19)15(20)18-7-5-17(6-8-18)11(2)14(16)21/h3-4,9,11,19H,5-8H2,1-2H3,(H2,16,21) |
| InChIKey | XJRPCGOZCYTFDC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|