C14H16Cl2N2O — CID 107676093
1-(5,7-dichloro-1,3-benzoxazol-2-yl)-3-methylcyclohexan-1-amine (PubChem CID 107676093) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 1-(5,7-dichloro-1,3-benzoxazol-2-yl)-3-methylcyclohexan-1-amine.
| Compound Name | 1-(5,7-dichloro-1,3-benzoxazol-2-yl)-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 107676093 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(5,7-dichloro-1,3-benzoxazol-2-yl)-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(N)(c2nc3cc(Cl)cc(Cl)c3o2)C1 |
| InChI | InChI=1S/C14H16Cl2N2O/c1-8-3-2-4-14(17,7-8)13-18-11-6-9(15)5-10(16)12(11)19-13/h5-6,8H,2-4,7,17H2,1H3 |
| InChIKey | GVXPXPDKLILVJJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |