C26H26O10 — CID 10767630
(4aS,12S,12aS)-3-acetyl-4,4a,6,7,12,12a-hexahydroxy-9-methoxy-11-(3-methylbut-2-enyl)-1,12-dihydrotetracene-2,5-dione (PubChem CID 10767630) has the molecular formula C26H26O10 and a molecular weight of 498.48 g/mol. Its IUPAC name is (4aS,12S,12aS)-3-acetyl-4,4a,6,7,12,12a-hexahydroxy-9-methoxy-11-(3-methylbut-2-enyl)-1,12-dihydrotetracene-2,5-dione.
| Compound Name | (4aS,12S,12aS)-3-acetyl-4,4a,6,7,12,12a-hexahydroxy-9-methoxy-11-(3-methylbut-2-enyl)-1,12-dihydrotetracene-2,5-dione |
|---|---|
| PubChem CID | 10767630 |
| Molecular Formula | C26H26O10 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (4aS,12S,12aS)-3-acetyl-4,4a,6,7,12,12a-hexahydroxy-9-methoxy-11-(3-methylbut-2-enyl)-1,12-dihydrotetracene-2,5-dione |
| SMILES | COc1cc(O)c2c(O)c3c(c(CC=C(C)C)c2c1)[C@H](O)[C@@]1(O)CC(=O)C(C(C)=O)=C(O)[C@@]1(O)C3=O |
| InChI | InChI=1S/C26H26O10/c1-10(2)5-6-13-14-7-12(36-4)8-15(28)18(14)21(30)20-19(13)22(31)25(34)9-16(29)17(11(3)27)23(32)26(25,35)24(20)33/h5,7-8,22,28,30-32,34-35H,6,9H2,1-4H3/t22-,25-,26+/m0/s1 |
| InChIKey | YRQJWWGXADJAPA-UCGXPXSYSA-N |
| XLogP | 1.83 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|