C16H15Cl2NO — CID 107676512
6,8-dichloro-2-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 107676512) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 6,8-dichloro-2-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6,8-dichloro-2-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 107676512 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6,8-dichloro-2-(4-ethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCc1ccc(C2CNc3cc(Cl)cc(Cl)c3O2)cc1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-2-10-3-5-11(6-4-10)15-9-19-14-8-12(17)7-13(18)16(14)20-15/h3-8,15,19H,2,9H2,1H3 |
| InChIKey | GCWZTBZCZPCAKE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |