C26H37N3O5Si — CID 10767680
[(2R,3R)-4-(azidomethyl)-2,3-bis(methoxymethoxy)pent-4-enoxy]-tert-butyl-diphenylsilane (PubChem CID 10767680) has the molecular formula C26H37N3O5Si and a molecular weight of 499.68 g/mol. Its IUPAC name is [(2R,3R)-4-(azidomethyl)-2,3-bis(methoxymethoxy)pent-4-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3R)-4-(azidomethyl)-2,3-bis(methoxymethoxy)pent-4-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10767680 |
| Molecular Formula | C26H37N3O5Si |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | [(2R,3R)-4-(azidomethyl)-2,3-bis(methoxymethoxy)pent-4-enoxy]-tert-butyl-diphenylsilane |
| SMILES | C=C(CN=[N+]=[N-])[C@@H](OCOC)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC |
| InChI | InChI=1S/C26H37N3O5Si/c1-21(17-28-29-27)25(33-20-31-6)24(32-19-30-5)18-34-35(26(2,3)4,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,24-25H,1,17-20H2,2-6H3/t24-,25-/m1/s1 |
| InChIKey | TXKGZXUSMLMUSJ-JWQCQUIFSA-N |
| XLogP | 4.41 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|