About bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium
bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium (PubChem CID 10767691) has the molecular formula C24H26N3O4+
and a molecular weight of 420.49 g/mol. Its IUPAC name is bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium.
Molecular Properties
| Compound Name | bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium |
| PubChem CID | 10767691 |
| Molecular Formula | C24H26N3O4+ |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H26N3O4/c1-27(2,15-7-13-25-21(28)17-9-3-4-10-18(17)22(25)29)16-8-14-26-23(30)19-11-5-6-12-20(19)24(26)31/h3-6,9-12H,7-8,13-16H2,1-2H3/q+1 |
| InChIKey | WZSFQQFIWVDJHH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium?
The IUPAC name of bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium (CID 10767691) is bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium.
What is the SMILES notation for bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium?
The canonical SMILES for bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium is C[N+](C)(CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium?
The InChIKey is WZSFQQFIWVDJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N3O4/c1-27(2,15-7-13-25-21(28)17-9-3-4-10-18(17)22(25)29)16-8-14-26-23(30)19-11-5-6-12-20(19)24(26)31/h3-6,9-12H,7-8,13-16H2,1-2H3/q+1.
What are the key properties of bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium?
bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium has a molecular weight of 420.49 g/mol, XLogP of 2.44, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(1,3-dioxoisoindol-2-yl)propyl]-dimethylazanium is sourced from PubChem (CID 10767691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).