C29H29FN4O3 — CID 10767708
1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 10767708) has the molecular formula C29H29FN4O3 and a molecular weight of 500.57 g/mol. Its IUPAC name is 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 10767708 |
| Molecular Formula | C29H29FN4O3 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-[1-(2-cyclopentylethyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1C(=O)N(CCC2CCCC2)c2ccccc2N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C29H29FN4O3/c30-22-14-6-7-15-23(22)34-25-17-9-8-16-24(25)33(19-18-20-10-4-5-11-20)27(35)26(28(34)36)32-29(37)31-21-12-2-1-3-13-21/h1-3,6-9,12-17,20,26H,4-5,10-11,18-19H2,(H2,31,32,37) |
| InChIKey | LCHUVBRBWHZIGO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|