C14H20ClNO2 — CID 107678106
2-chloro-4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenol (PubChem CID 107678106) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 2-chloro-4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenol.
| Compound Name | 2-chloro-4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenol |
|---|---|
| PubChem CID | 107678106 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-chloro-4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]phenol |
| SMILES | CCOC1CC(Nc2ccc(O)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C14H20ClNO2/c1-4-18-13-8-12(14(13,2)3)16-9-5-6-11(17)10(15)7-9/h5-7,12-13,16-17H,4,8H2,1-3H3 |
| InChIKey | HODNXZAWRHCYTQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|