C17H18ClN5O7S2 — CID 10767828
2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate (PubChem CID 10767828) has the molecular formula C17H18ClN5O7S2 and a molecular weight of 503.95 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate.
| Compound Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10767828 |
| Molecular Formula | C17H18ClN5O7S2 |
| Molecular Weight | 503.95 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)Nc1nnc(S(N)(=O)=O)s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H17N5O3S2.ClHO4/c1-11-8-14(13-6-4-3-5-7-13)9-12(2)22(11)10-15(23)19-16-20-21-17(26-16)27(18,24)25;2-1(3,4)5/h3-9H,10H2,1-2H3,(H2-,18,19,20,23,24,25);(H,2,3,4,5) |
| InChIKey | PZADZOWZNUICQE-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.95 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|