C13H10BrCl2NO2 — CID 107678911
4-[(3-bromo-4-hydroxyphenyl)methylamino]-2,6-dichlorophenol (PubChem CID 107678911) has the molecular formula C13H10BrCl2NO2 and a molecular weight of 363.04 g/mol. Its IUPAC name is 4-[(3-bromo-4-hydroxyphenyl)methylamino]-2,6-dichlorophenol.
| Compound Name | 4-[(3-bromo-4-hydroxyphenyl)methylamino]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 107678911 |
| Molecular Formula | C13H10BrCl2NO2 |
| Molecular Weight | 363.04 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 4-[(3-bromo-4-hydroxyphenyl)methylamino]-2,6-dichlorophenol |
| SMILES | Oc1ccc(CNc2cc(Cl)c(O)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C13H10BrCl2NO2/c14-9-3-7(1-2-12(9)18)6-17-8-4-10(15)13(19)11(16)5-8/h1-5,17-19H,6H2 |
| InChIKey | KLHIIKYYAWQMDB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|